Victor2006 Victor2006

19-10-2016
Mathematics

contestada

What is the value of the expression (9+5) divided by 3 x 2

Respuesta :

Аноним Аноним

19-10-2016

the 9+5 is 14, and 3x 2 is 6 so it is 2r2 hope i helped

Answer Link

Аноним Аноним

19-10-2016

2 remainder of 2 because 9+5=14and3×2is6!and 14÷6=2r2

Answer Link

Otras preguntas

where did conquistadors claim land?

In what ways did the expansion of Islam affect the prosperity of groups in East Africa? What does the rise and fall of Great Zimbabwe demonstrate about souther

Economic regulation occurs when a. monopoly is the optimal market structure. b. the industry is highly competitive. c. the product is important to economic welf

Which compound has the highest melting point? ch3(ch2)14cooh ch3(ch2)10ch=ch(ch2)2cooh ch3(ch2)2ch=ch(ch2)4ch=ch(ch2)4cooh ch3(ch2)2ch=ch(ch2)2ch=ch(ch2)2ch=ch(

Brainstorm a list of pros and cons for the school adopting a policy that requires students to complete one hundred hours of community service before graduation.

Hypnotic responsiveness is: a. the same in all people. b. generally greater in women than men. c. generally greater in men than women. d. greater when people ar

need help fast 100 points

What is the difference between negative displacement and negative velocity?

How many offspring an individual can have in a lifetime is called?

Why does King repeat the phrase “i refuse to accept” in this passage